C21H26FN — CID 145066225
5-fluoro-2-(1,1,2,2,3,3,6-heptamethylinden-5-yl)pyridine (PubChem CID 145066225) has the molecular formula C21H26FN and a molecular weight of 311.44 g/mol. Its IUPAC name is 5-fluoro-2-(1,1,2,2,3,3,6-heptamethylinden-5-yl)pyridine.
| Compound Name | 5-fluoro-2-(1,1,2,2,3,3,6-heptamethylinden-5-yl)pyridine |
|---|---|
| PubChem CID | 145066225 |
| Molecular Formula | C21H26FN |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 5-fluoro-2-(1,1,2,2,3,3,6-heptamethylinden-5-yl)pyridine |
| SMILES | Cc1cc2c(cc1-c1ccc(F)cn1)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C21H26FN/c1-13-10-16-17(20(4,5)21(6,7)19(16,2)3)11-15(13)18-9-8-14(22)12-23-18/h8-12H,1-7H3 |
| InChIKey | NIWBBVGARZGOLM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |