About 2-[3-(4-ethynyl-2,6-dimethylphenyl)-2-methylidene-4-oxocyclopentyl]-N-propan-2-ylacetamide
2-[3-(4-ethynyl-2,6-dimethylphenyl)-2-methylidene-4-oxocyclopentyl]-N-propan-2-ylacetamide (PubChem CID 145066331) has the molecular formula C21H25NO2
and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-[3-(4-ethynyl-2,6-dimethylphenyl)-2-methylidene-4-oxocyclopentyl]-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-[3-(4-ethynyl-2,6-dimethylphenyl)-2-methylidene-4-oxocyclopentyl]-N-propan-2-ylacetamide |
| PubChem CID | 145066331 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 2-[3-(4-ethynyl-2,6-dimethylphenyl)-2-methylidene-4-oxocyclopentyl]-N-propan-2-ylacetamide |
| SMILES | C#Cc1cc(C)c(C2C(=C)C(CC(=O)NC(C)C)CC2=O)c(C)c1 |
| InChI | InChI=1S/C21H25NO2/c1-7-16-8-13(4)20(14(5)9-16)21-15(6)17(10-18(21)23)11-19(24)22-12(2)3/h1,8-9,12,17,21H,6,10-11H2,2-5H3,(H,22,24) |
| InChIKey | MGKSOOCUEJXRMG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(4-ethynyl-2,6-dimethylphenyl)-2-methylidene-4-oxocyclopentyl]-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4-ethynyl-2,6-dimethylphenyl)-2-methylidene-4-oxocyclopentyl]-N-propan-2-ylacetamide?
The IUPAC name of 2-[3-(4-ethynyl-2,6-dimethylphenyl)-2-methylidene-4-oxocyclopentyl]-N-propan-2-ylacetamide (CID 145066331) is 2-[3-(4-ethynyl-2,6-dimethylphenyl)-2-methylidene-4-oxocyclopentyl]-N-propan-2-ylacetamide.
What is the SMILES notation for 2-[3-(4-ethynyl-2,6-dimethylphenyl)-2-methylidene-4-oxocyclopentyl]-N-propan-2-ylacetamide?
The canonical SMILES for 2-[3-(4-ethynyl-2,6-dimethylphenyl)-2-methylidene-4-oxocyclopentyl]-N-propan-2-ylacetamide is C#Cc1cc(C)c(C2C(=C)C(CC(=O)NC(C)C)CC2=O)c(C)c1.
What is the InChIKey of 2-[3-(4-ethynyl-2,6-dimethylphenyl)-2-methylidene-4-oxocyclopentyl]-N-propan-2-ylacetamide?
The InChIKey is MGKSOOCUEJXRMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO2/c1-7-16-8-13(4)20(14(5)9-16)21-15(6)17(10-18(21)23)11-19(24)22-12(2)3/h1,8-9,12,17,21H,6,10-11H2,2-5H3,(H,22,24).
What are the key properties of 2-[3-(4-ethynyl-2,6-dimethylphenyl)-2-methylidene-4-oxocyclopentyl]-N-propan-2-ylacetamide?
2-[3-(4-ethynyl-2,6-dimethylphenyl)-2-methylidene-4-oxocyclopentyl]-N-propan-2-ylacetamide has a molecular weight of 323.44 g/mol, XLogP of 3.43, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-ethynyl-2,6-dimethylphenyl)-2-methylidene-4-oxocyclopentyl]-N-propan-2-ylacetamide is sourced from PubChem (CID 145066331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).