About chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine
chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine (PubChem CID 145067976) has the molecular formula C14H23ClN3+
and a molecular weight of 268.81 g/mol. Its IUPAC name is chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine.
Molecular Properties
| Compound Name | chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine |
| PubChem CID | 145067976 |
| Molecular Formula | C14H23ClN3+ |
| Molecular Weight | 268.81 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine |
| SMILES | CC.CCl.C[n+]1ccn(-c2ccc(CN)cc2)c1 |
| InChI | InChI=1S/C11H14N3.C2H6.CH3Cl/c1-13-6-7-14(9-13)11-4-2-10(8-12)3-5-11;2*1-2/h2-7,9H,8,12H2,1H3;1-2H3;1H3/q+1;; |
| InChIKey | GIRBVXUMNHZQJN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 34.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.81 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine?
The IUPAC name of chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine (CID 145067976) is chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine.
What is the SMILES notation for chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine?
The canonical SMILES for chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine is CC.CCl.C[n+]1ccn(-c2ccc(CN)cc2)c1.
What is the InChIKey of chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine?
The InChIKey is GIRBVXUMNHZQJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N3.C2H6.CH3Cl/c1-13-6-7-14(9-13)11-4-2-10(8-12)3-5-11;2*1-2/h2-7,9H,8,12H2,1H3;1-2H3;1H3/q+1;;.
What are the key properties of chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine?
chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine has a molecular weight of 268.81 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine is sourced from PubChem (CID 145067976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).