C14H23ClN3+ — CID 145067976
chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine (PubChem CID 145067976) has the molecular formula C14H23ClN3+ and a molecular weight of 268.81 g/mol. Its IUPAC name is chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine.
| Compound Name | chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 145067976 |
| Molecular Formula | C14H23ClN3+ |
| Molecular Weight | 268.81 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | chloromethane;ethane;[4-(3-methylimidazol-3-ium-1-yl)phenyl]methanamine |
| SMILES | CC.CCl.C[n+]1ccn(-c2ccc(CN)cc2)c1 |
| InChI | InChI=1S/C11H14N3.C2H6.CH3Cl/c1-13-6-7-14(9-13)11-4-2-10(8-12)3-5-11;2*1-2/h2-7,9H,8,12H2,1H3;1-2H3;1H3/q+1;; |
| InChIKey | GIRBVXUMNHZQJN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 34.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.81 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|