C10H9O10P-4 — CID 14506801
(3R,4S,5R)-5-(1-carboxylatoethenoxy)-4-hydroxy-3-phosphonatooxycyclohexene-1-carboxylate (PubChem CID 14506801) has the molecular formula C10H9O10P-4 and a molecular weight of 320.15 g/mol. Its IUPAC name is (3R,4S,5R)-5-(1-carboxylatoethenoxy)-4-hydroxy-3-phosphonatooxycyclohexene-1-carboxylate.
| Compound Name | (3R,4S,5R)-5-(1-carboxylatoethenoxy)-4-hydroxy-3-phosphonatooxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 14506801 |
| Molecular Formula | C10H9O10P-4 |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | (3R,4S,5R)-5-(1-carboxylatoethenoxy)-4-hydroxy-3-phosphonatooxycyclohexene-1-carboxylate |
| SMILES | C=C(O[C@@H]1CC(C(=O)[O-])=C[C@@H](OP(=O)([O-])[O-])[C@H]1O)C(=O)[O-] |
| InChI | InChI=1S/C10H13O10P/c1-4(9(12)13)19-6-2-5(10(14)15)3-7(8(6)11)20-21(16,17)18/h3,6-8,11H,1-2H2,(H,12,13)(H,14,15)(H2,16,17,18)/p-4/t6-,7-,8+/m1/s1 |
| InChIKey | QUTYKIXIUDQOLK-PRJMDXOYSA-J |
| XLogP | -4.71 |
| TPSA | 182.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | -4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|