C7H8O8P-3 — CID 14506806
(3R,4S,5R)-4,5-dihydroxy-3-phosphonatooxycyclohexene-1-carboxylate (PubChem CID 14506806) has the molecular formula C7H8O8P-3 and a molecular weight of 251.11 g/mol. Its IUPAC name is (3R,4S,5R)-4,5-dihydroxy-3-phosphonatooxycyclohexene-1-carboxylate.
| Compound Name | (3R,4S,5R)-4,5-dihydroxy-3-phosphonatooxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 14506806 |
| Molecular Formula | C7H8O8P-3 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | (3R,4S,5R)-4,5-dihydroxy-3-phosphonatooxycyclohexene-1-carboxylate |
| SMILES | O=C([O-])C1=C[C@@H](OP(=O)([O-])[O-])[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C7H11O8P/c8-4-1-3(7(10)11)2-5(6(4)9)15-16(12,13)14/h2,4-6,8-9H,1H2,(H,10,11)(H2,12,13,14)/p-3/t4-,5-,6+/m1/s1 |
| InChIKey | QYOJSKGCWNAKGW-PBXRRBTRSA-K |
| XLogP | -4.00 |
| TPSA | 153.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|