C16H26N2 — CID 145068829
(2Z)-2,3-bis(ethenyl)-N-methyl-4-[(Z)-prop-1-enyl]iminohexa-2,5-dien-1-amine;ethane (PubChem CID 145068829) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (2Z)-2,3-bis(ethenyl)-N-methyl-4-[(Z)-prop-1-enyl]iminohexa-2,5-dien-1-amine;ethane.
| Compound Name | (2Z)-2,3-bis(ethenyl)-N-methyl-4-[(Z)-prop-1-enyl]iminohexa-2,5-dien-1-amine;ethane |
|---|---|
| PubChem CID | 145068829 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (2Z)-2,3-bis(ethenyl)-N-methyl-4-[(Z)-prop-1-enyl]iminohexa-2,5-dien-1-amine;ethane |
| SMILES | C=C/C(CNC)=C(C=C)/C(C=C)=N/C=C\C.CC |
| InChI | InChI=1S/C14H20N2.C2H6/c1-6-10-16-14(9-4)13(8-3)12(7-2)11-15-5;1-2/h6-10,15H,2-4,11H2,1,5H3;1-2H3/b10-6-,13-12-,16-14+; |
| InChIKey | WUSRBPNYMJIMDL-APJYIPDRSA-N |
| XLogP | 4.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|