C27H32N4O10 — CID 145068868
amino 1-acetylpyrrole-2-carboxylate;methyl 4-[(E)-3-methoxy-3-oxoprop-1-enyl]-1H-pyrrole-2-carboxylate;methyl 1-(2-methylpropanoyl)pyrrole-2-carboxylate (PubChem CID 145068868) has the molecular formula C27H32N4O10 and a molecular weight of 572.57 g/mol. Its IUPAC name is amino 1-acetylpyrrole-2-carboxylate;methyl 4-[(E)-3-methoxy-3-oxoprop-1-enyl]-1H-pyrrole-2-carboxylate;methyl 1-(2-methylpropanoyl)pyrrole-2-carboxylate.
| Compound Name | amino 1-acetylpyrrole-2-carboxylate;methyl 4-[(E)-3-methoxy-3-oxoprop-1-enyl]-1H-pyrrole-2-carboxylate;methyl 1-(2-methylpropanoyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 145068868 |
| Molecular Formula | C27H32N4O10 |
| Molecular Weight | 572.57 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | amino 1-acetylpyrrole-2-carboxylate;methyl 4-[(E)-3-methoxy-3-oxoprop-1-enyl]-1H-pyrrole-2-carboxylate;methyl 1-(2-methylpropanoyl)pyrrole-2-carboxylate |
| SMILES | CC(=O)n1cccc1C(=O)ON.COC(=O)/C=C/c1c[nH]c(C(=O)OC)c1.COC(=O)c1cccn1C(=O)C(C)C |
| InChI | InChI=1S/C10H11NO4.C10H13NO3.C7H8N2O3/c1-14-9(12)4-3-7-5-8(11-6-7)10(13)15-2;1-7(2)9(12)11-6-4-5-8(11)10(13)14-3;1-5(10)9-4-2-3-6(9)7(11)12-8/h3-6,11H,1-2H3;4-7H,1-3H3;2-4H,8H2,1H3/b4-3+;; |
| InChIKey | JKTPYQBQCCTHMA-CZEFNJPISA-N |
| XLogP | 2.74 |
| TPSA | 191.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|