About tert-butyl 3-[[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazol-1-yl]methyl]pyrrolidine-1-carboxylate
tert-butyl 3-[[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazol-1-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 145069003) has the molecular formula C17H25N5O2S
and a molecular weight of 363.49 g/mol. Its IUPAC name is tert-butyl 3-[[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazol-1-yl]methyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-[[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazol-1-yl]methyl]pyrrolidine-1-carboxylate |
| PubChem CID | 145069003 |
| Molecular Formula | C17H25N5O2S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | tert-butyl 3-[[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazol-1-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1cnc(Nc2ccn(CC3CCN(C(=O)OC(C)(C)C)C3)n2)s1 |
| InChI | InChI=1S/C17H25N5O2S/c1-12-9-18-15(25-12)19-14-6-8-22(20-14)11-13-5-7-21(10-13)16(23)24-17(2,3)4/h6,8-9,13H,5,7,10-11H2,1-4H3,(H,18,19,20) |
| InChIKey | YUQBOLDFJNIMSL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl 3-[[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazol-1-yl]methyl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazol-1-yl]methyl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl 3-[[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazol-1-yl]methyl]pyrrolidine-1-carboxylate (CID 145069003) is tert-butyl 3-[[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazol-1-yl]methyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3-[[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazol-1-yl]methyl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl 3-[[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazol-1-yl]methyl]pyrrolidine-1-carboxylate is Cc1cnc(Nc2ccn(CC3CCN(C(=O)OC(C)(C)C)C3)n2)s1.
What is the InChIKey of tert-butyl 3-[[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazol-1-yl]methyl]pyrrolidine-1-carboxylate?
The InChIKey is YUQBOLDFJNIMSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N5O2S/c1-12-9-18-15(25-12)19-14-6-8-22(20-14)11-13-5-7-21(10-13)16(23)24-17(2,3)4/h6,8-9,13H,5,7,10-11H2,1-4H3,(H,18,19,20).
What are the key properties of tert-butyl 3-[[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazol-1-yl]methyl]pyrrolidine-1-carboxylate?
tert-butyl 3-[[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazol-1-yl]methyl]pyrrolidine-1-carboxylate has a molecular weight of 363.49 g/mol, XLogP of 3.65, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazol-1-yl]methyl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 145069003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).