C14H24O2 — CID 145069496
[(1R,8aS)-1-methyl-6-methylidene-2,3,4,4a,5,7,8,8a-octahydronaphthalen-1-yl]methoxymethanol (PubChem CID 145069496) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is [(1R,8aS)-1-methyl-6-methylidene-2,3,4,4a,5,7,8,8a-octahydronaphthalen-1-yl]methoxymethanol.
| Compound Name | [(1R,8aS)-1-methyl-6-methylidene-2,3,4,4a,5,7,8,8a-octahydronaphthalen-1-yl]methoxymethanol |
|---|---|
| PubChem CID | 145069496 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | [(1R,8aS)-1-methyl-6-methylidene-2,3,4,4a,5,7,8,8a-octahydronaphthalen-1-yl]methoxymethanol |
| SMILES | C=C1CC[C@H]2C(CCC[C@@]2(C)COCO)C1 |
| InChI | InChI=1S/C14H24O2/c1-11-5-6-13-12(8-11)4-3-7-14(13,2)9-16-10-15/h12-13,15H,1,3-10H2,2H3/t12?,13-,14-/m0/s1 |
| InChIKey | CFSXNHNQGCZJTJ-TTZKSVMKSA-N |
| XLogP | 3.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|