About ethane;2-(3-piperidin-3-yl-1,2,4-oxadiazol-5-yl)propan-2-ol
ethane;2-(3-piperidin-3-yl-1,2,4-oxadiazol-5-yl)propan-2-ol (PubChem CID 145069755) has the molecular formula C12H23N3O2
and a molecular weight of 241.33 g/mol. Its IUPAC name is ethane;2-(3-piperidin-3-yl-1,2,4-oxadiazol-5-yl)propan-2-ol.
Molecular Properties
| Compound Name | ethane;2-(3-piperidin-3-yl-1,2,4-oxadiazol-5-yl)propan-2-ol |
| PubChem CID | 145069755 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | ethane;2-(3-piperidin-3-yl-1,2,4-oxadiazol-5-yl)propan-2-ol |
| SMILES | CC.CC(C)(O)c1nc(C2CCCNC2)no1 |
| InChI | InChI=1S/C10H17N3O2.C2H6/c1-10(2,14)9-12-8(13-15-9)7-4-3-5-11-6-7;1-2/h7,11,14H,3-6H2,1-2H3;1-2H3 |
| InChIKey | GBIGFWACSFEHQE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;2-(3-piperidin-3-yl-1,2,4-oxadiazol-5-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(3-piperidin-3-yl-1,2,4-oxadiazol-5-yl)propan-2-ol?
The IUPAC name of ethane;2-(3-piperidin-3-yl-1,2,4-oxadiazol-5-yl)propan-2-ol (CID 145069755) is ethane;2-(3-piperidin-3-yl-1,2,4-oxadiazol-5-yl)propan-2-ol.
What is the SMILES notation for ethane;2-(3-piperidin-3-yl-1,2,4-oxadiazol-5-yl)propan-2-ol?
The canonical SMILES for ethane;2-(3-piperidin-3-yl-1,2,4-oxadiazol-5-yl)propan-2-ol is CC.CC(C)(O)c1nc(C2CCCNC2)no1.
What is the InChIKey of ethane;2-(3-piperidin-3-yl-1,2,4-oxadiazol-5-yl)propan-2-ol?
The InChIKey is GBIGFWACSFEHQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2.C2H6/c1-10(2,14)9-12-8(13-15-9)7-4-3-5-11-6-7;1-2/h7,11,14H,3-6H2,1-2H3;1-2H3.
What are the key properties of ethane;2-(3-piperidin-3-yl-1,2,4-oxadiazol-5-yl)propan-2-ol?
ethane;2-(3-piperidin-3-yl-1,2,4-oxadiazol-5-yl)propan-2-ol has a molecular weight of 241.33 g/mol, XLogP of 1.79, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(3-piperidin-3-yl-1,2,4-oxadiazol-5-yl)propan-2-ol is sourced from PubChem (CID 145069755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).