About (6R)-1-[2-[bis(methylideneamino)amino]benzoyl]-6-methylpiperidine-3-carboxylic acid;ethane
(6R)-1-[2-[bis(methylideneamino)amino]benzoyl]-6-methylpiperidine-3-carboxylic acid;ethane (PubChem CID 145069806) has the molecular formula C18H26N4O3
and a molecular weight of 346.43 g/mol. Its IUPAC name is (6R)-1-[2-[bis(methylideneamino)amino]benzoyl]-6-methylpiperidine-3-carboxylic acid;ethane.
Molecular Properties
| Compound Name | (6R)-1-[2-[bis(methylideneamino)amino]benzoyl]-6-methylpiperidine-3-carboxylic acid;ethane |
| PubChem CID | 145069806 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (6R)-1-[2-[bis(methylideneamino)amino]benzoyl]-6-methylpiperidine-3-carboxylic acid;ethane |
| SMILES | C=NN(N=C)c1ccccc1C(=O)N1CC(C(=O)O)CC[C@H]1C.CC |
| InChI | InChI=1S/C16H20N4O3.C2H6/c1-11-8-9-12(16(22)23)10-19(11)15(21)13-6-4-5-7-14(13)20(17-2)18-3;1-2/h4-7,11-12H,2-3,8-10H2,1H3,(H,22,23);1-2H3/t11-,12?;/m1./s1 |
| InChIKey | GABJWSYVGGBRSU-BAVFUAOSSA-N |
| XLogP | 3.08 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6R)-1-[2-[bis(methylideneamino)amino]benzoyl]-6-methylpiperidine-3-carboxylic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-1-[2-[bis(methylideneamino)amino]benzoyl]-6-methylpiperidine-3-carboxylic acid;ethane?
The IUPAC name of (6R)-1-[2-[bis(methylideneamino)amino]benzoyl]-6-methylpiperidine-3-carboxylic acid;ethane (CID 145069806) is (6R)-1-[2-[bis(methylideneamino)amino]benzoyl]-6-methylpiperidine-3-carboxylic acid;ethane.
What is the SMILES notation for (6R)-1-[2-[bis(methylideneamino)amino]benzoyl]-6-methylpiperidine-3-carboxylic acid;ethane?
The canonical SMILES for (6R)-1-[2-[bis(methylideneamino)amino]benzoyl]-6-methylpiperidine-3-carboxylic acid;ethane is C=NN(N=C)c1ccccc1C(=O)N1CC(C(=O)O)CC[C@H]1C.CC.
What is the InChIKey of (6R)-1-[2-[bis(methylideneamino)amino]benzoyl]-6-methylpiperidine-3-carboxylic acid;ethane?
The InChIKey is GABJWSYVGGBRSU-BAVFUAOSSA-N. The full InChI is InChI=1S/C16H20N4O3.C2H6/c1-11-8-9-12(16(22)23)10-19(11)15(21)13-6-4-5-7-14(13)20(17-2)18-3;1-2/h4-7,11-12H,2-3,8-10H2,1H3,(H,22,23);1-2H3/t11-,12?;/m1./s1.
What are the key properties of (6R)-1-[2-[bis(methylideneamino)amino]benzoyl]-6-methylpiperidine-3-carboxylic acid;ethane?
(6R)-1-[2-[bis(methylideneamino)amino]benzoyl]-6-methylpiperidine-3-carboxylic acid;ethane has a molecular weight of 346.43 g/mol, XLogP of 3.08, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-1-[2-[bis(methylideneamino)amino]benzoyl]-6-methylpiperidine-3-carboxylic acid;ethane is sourced from PubChem (CID 145069806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).