C20H32N8O3 — CID 145069921
ethane;methyl (2Z)-2-amino-2-[amino-(1-methylpiperidin-3-yl)hydrazinylidene]acetate;2-(triazol-2-yl)benzaldehyde (PubChem CID 145069921) has the molecular formula C20H32N8O3 and a molecular weight of 432.53 g/mol. Its IUPAC name is ethane;methyl (2Z)-2-amino-2-[amino-(1-methylpiperidin-3-yl)hydrazinylidene]acetate;2-(triazol-2-yl)benzaldehyde.
| Compound Name | ethane;methyl (2Z)-2-amino-2-[amino-(1-methylpiperidin-3-yl)hydrazinylidene]acetate;2-(triazol-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 145069921 |
| Molecular Formula | C20H32N8O3 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | ethane;methyl (2Z)-2-amino-2-[amino-(1-methylpiperidin-3-yl)hydrazinylidene]acetate;2-(triazol-2-yl)benzaldehyde |
| SMILES | CC.COC(=O)/C(N)=N/N(N)C1CCCN(C)C1.O=Cc1ccccc1-n1nccn1 |
| InChI | InChI=1S/C9H19N5O2.C9H7N3O.C2H6/c1-13-5-3-4-7(6-13)14(11)12-8(10)9(15)16-2;13-7-8-3-1-2-4-9(8)12-10-5-6-11-12;1-2/h7H,3-6,11H2,1-2H3,(H2,10,12);1-7H;1-2H3 |
| InChIKey | BXVOXOWJFRYEIQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 144.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|