About 4-[[2-fluoro-3-(methylamino)phenyl]methylamino]-2-prop-2-enyl-3H-isoindol-1-one;methylcarbamic acid
4-[[2-fluoro-3-(methylamino)phenyl]methylamino]-2-prop-2-enyl-3H-isoindol-1-one;methylcarbamic acid (PubChem CID 145069992) has the molecular formula C21H25FN4O3
and a molecular weight of 400.45 g/mol. Its IUPAC name is 4-[[2-fluoro-3-(methylamino)phenyl]methylamino]-2-prop-2-enyl-3H-isoindol-1-one;methylcarbamic acid.
Molecular Properties
| Compound Name | 4-[[2-fluoro-3-(methylamino)phenyl]methylamino]-2-prop-2-enyl-3H-isoindol-1-one;methylcarbamic acid |
| PubChem CID | 145069992 |
| Molecular Formula | C21H25FN4O3 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 4-[[2-fluoro-3-(methylamino)phenyl]methylamino]-2-prop-2-enyl-3H-isoindol-1-one;methylcarbamic acid |
| SMILES | C=CCN1Cc2c(NCc3cccc(NC)c3F)cccc2C1=O.CNC(=O)O |
| InChI | InChI=1S/C19H20FN3O.C2H5NO2/c1-3-10-23-12-15-14(19(23)24)7-5-8-16(15)22-11-13-6-4-9-17(21-2)18(13)20;1-3-2(4)5/h3-9,21-22H,1,10-12H2,2H3;3H,1H3,(H,4,5) |
| InChIKey | ULKFFAAXVIIBGA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[[2-fluoro-3-(methylamino)phenyl]methylamino]-2-prop-2-enyl-3H-isoindol-1-one;methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-fluoro-3-(methylamino)phenyl]methylamino]-2-prop-2-enyl-3H-isoindol-1-one;methylcarbamic acid?
The IUPAC name of 4-[[2-fluoro-3-(methylamino)phenyl]methylamino]-2-prop-2-enyl-3H-isoindol-1-one;methylcarbamic acid (CID 145069992) is 4-[[2-fluoro-3-(methylamino)phenyl]methylamino]-2-prop-2-enyl-3H-isoindol-1-one;methylcarbamic acid.
What is the SMILES notation for 4-[[2-fluoro-3-(methylamino)phenyl]methylamino]-2-prop-2-enyl-3H-isoindol-1-one;methylcarbamic acid?
The canonical SMILES for 4-[[2-fluoro-3-(methylamino)phenyl]methylamino]-2-prop-2-enyl-3H-isoindol-1-one;methylcarbamic acid is C=CCN1Cc2c(NCc3cccc(NC)c3F)cccc2C1=O.CNC(=O)O.
What is the InChIKey of 4-[[2-fluoro-3-(methylamino)phenyl]methylamino]-2-prop-2-enyl-3H-isoindol-1-one;methylcarbamic acid?
The InChIKey is ULKFFAAXVIIBGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FN3O.C2H5NO2/c1-3-10-23-12-15-14(19(23)24)7-5-8-16(15)22-11-13-6-4-9-17(21-2)18(13)20;1-3-2(4)5/h3-9,21-22H,1,10-12H2,2H3;3H,1H3,(H,4,5).
What are the key properties of 4-[[2-fluoro-3-(methylamino)phenyl]methylamino]-2-prop-2-enyl-3H-isoindol-1-one;methylcarbamic acid?
4-[[2-fluoro-3-(methylamino)phenyl]methylamino]-2-prop-2-enyl-3H-isoindol-1-one;methylcarbamic acid has a molecular weight of 400.45 g/mol, XLogP of 3.51, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-fluoro-3-(methylamino)phenyl]methylamino]-2-prop-2-enyl-3H-isoindol-1-one;methylcarbamic acid is sourced from PubChem (CID 145069992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).