About (2,6-dimethylmorpholin-4-yl)-(3-fluoro-4-methylphenyl)methanediol;ethane
(2,6-dimethylmorpholin-4-yl)-(3-fluoro-4-methylphenyl)methanediol;ethane (PubChem CID 145069999) has the molecular formula C18H32FNO3
and a molecular weight of 329.46 g/mol. Its IUPAC name is (2,6-dimethylmorpholin-4-yl)-(3-fluoro-4-methylphenyl)methanediol;ethane.
Molecular Properties
| Compound Name | (2,6-dimethylmorpholin-4-yl)-(3-fluoro-4-methylphenyl)methanediol;ethane |
| PubChem CID | 145069999 |
| Molecular Formula | C18H32FNO3 |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | (2,6-dimethylmorpholin-4-yl)-(3-fluoro-4-methylphenyl)methanediol;ethane |
| SMILES | CC.CC.Cc1ccc(C(O)(O)N2CC(C)OC(C)C2)cc1F |
| InChI | InChI=1S/C14H20FNO3.2C2H6/c1-9-4-5-12(6-13(9)15)14(17,18)16-7-10(2)19-11(3)8-16;2*1-2/h4-6,10-11,17-18H,7-8H2,1-3H3;2*1-2H3 |
| InChIKey | MSLJPOSSMXKUHQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dimethylmorpholin-4-yl)-(3-fluoro-4-methylphenyl)methanediol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethylmorpholin-4-yl)-(3-fluoro-4-methylphenyl)methanediol;ethane?
The IUPAC name of (2,6-dimethylmorpholin-4-yl)-(3-fluoro-4-methylphenyl)methanediol;ethane (CID 145069999) is (2,6-dimethylmorpholin-4-yl)-(3-fluoro-4-methylphenyl)methanediol;ethane.
What is the SMILES notation for (2,6-dimethylmorpholin-4-yl)-(3-fluoro-4-methylphenyl)methanediol;ethane?
The canonical SMILES for (2,6-dimethylmorpholin-4-yl)-(3-fluoro-4-methylphenyl)methanediol;ethane is CC.CC.Cc1ccc(C(O)(O)N2CC(C)OC(C)C2)cc1F.
What is the InChIKey of (2,6-dimethylmorpholin-4-yl)-(3-fluoro-4-methylphenyl)methanediol;ethane?
The InChIKey is MSLJPOSSMXKUHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20FNO3.2C2H6/c1-9-4-5-12(6-13(9)15)14(17,18)16-7-10(2)19-11(3)8-16;2*1-2/h4-6,10-11,17-18H,7-8H2,1-3H3;2*1-2H3.
What are the key properties of (2,6-dimethylmorpholin-4-yl)-(3-fluoro-4-methylphenyl)methanediol;ethane?
(2,6-dimethylmorpholin-4-yl)-(3-fluoro-4-methylphenyl)methanediol;ethane has a molecular weight of 329.46 g/mol, XLogP of 3.39, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethylmorpholin-4-yl)-(3-fluoro-4-methylphenyl)methanediol;ethane is sourced from PubChem (CID 145069999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).