C30H40FN3O3 — CID 145070090
2-[[2-[[3-[(3,5-dimethylpiperidin-1-yl)methyl]-2-fluorophenyl]methylamino]-6-methylphenyl]methyl-ethenylamino]-2-hydroxypentanedial (PubChem CID 145070090) has the molecular formula C30H40FN3O3 and a molecular weight of 509.67 g/mol. Its IUPAC name is 2-[[2-[[3-[(3,5-dimethylpiperidin-1-yl)methyl]-2-fluorophenyl]methylamino]-6-methylphenyl]methyl-ethenylamino]-2-hydroxypentanedial.
| Compound Name | 2-[[2-[[3-[(3,5-dimethylpiperidin-1-yl)methyl]-2-fluorophenyl]methylamino]-6-methylphenyl]methyl-ethenylamino]-2-hydroxypentanedial |
|---|---|
| PubChem CID | 145070090 |
| Molecular Formula | C30H40FN3O3 |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.31 |
| IUPAC Name | 2-[[2-[[3-[(3,5-dimethylpiperidin-1-yl)methyl]-2-fluorophenyl]methylamino]-6-methylphenyl]methyl-ethenylamino]-2-hydroxypentanedial |
| SMILES | C=CN(Cc1c(C)cccc1NCc1cccc(CN2CC(C)CC(C)C2)c1F)C(O)(C=O)CCC=O |
| InChI | InChI=1S/C30H40FN3O3/c1-5-34(30(37,21-36)13-8-14-35)20-27-24(4)9-6-12-28(27)32-16-25-10-7-11-26(29(25)31)19-33-17-22(2)15-23(3)18-33/h5-7,9-12,14,21-23,32,37H,1,8,13,15-20H2,2-4H3 |
| InChIKey | LECLTZKGWKPRSP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|