C23H26FN3O4 — CID 145070308
2-[(3E,4Z)-3-[(Z)-but-2-enylidene]-4-[[(2-fluoro-3-formylphenyl)methylamino]methylidene]-2-oxopyrrolidin-1-yl]-N-methyl-5-oxopentanamide (PubChem CID 145070308) has the molecular formula C23H26FN3O4 and a molecular weight of 427.48 g/mol. Its IUPAC name is 2-[(3E,4Z)-3-[(Z)-but-2-enylidene]-4-[[(2-fluoro-3-formylphenyl)methylamino]methylidene]-2-oxopyrrolidin-1-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[(3E,4Z)-3-[(Z)-but-2-enylidene]-4-[[(2-fluoro-3-formylphenyl)methylamino]methylidene]-2-oxopyrrolidin-1-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 145070308 |
| Molecular Formula | C23H26FN3O4 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-[(3E,4Z)-3-[(Z)-but-2-enylidene]-4-[[(2-fluoro-3-formylphenyl)methylamino]methylidene]-2-oxopyrrolidin-1-yl]-N-methyl-5-oxopentanamide |
| SMILES | C/C=C\C=C1\C(=O)N(C(CCC=O)C(=O)NC)C\C1=C/NCc1cccc(C=O)c1F |
| InChI | InChI=1S/C23H26FN3O4/c1-3-4-9-19-18(13-26-12-16-7-5-8-17(15-29)21(16)24)14-27(23(19)31)20(10-6-11-28)22(30)25-2/h3-5,7-9,11,13,15,20,26H,6,10,12,14H2,1-2H3,(H,25,30)/b4-3-,18-13+,19-9+ |
| InChIKey | BTNOWYADYSUCQQ-KIZCUCFBSA-N |
| XLogP | 2.05 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|