C30H36FN3O9 — CID 145070821
5-[7-[[3-[(3,5-dimethylpiperidin-1-yl)methyl]-2-fluorophenyl]methoxy]-1,1-dihydroxy-3-methylideneisoindol-2-yl]-3,3,4,4,5-pentahydroxy-6-methylidenepiperidin-2-one (PubChem CID 145070821) has the molecular formula C30H36FN3O9 and a molecular weight of 601.63 g/mol. Its IUPAC name is 5-[7-[[3-[(3,5-dimethylpiperidin-1-yl)methyl]-2-fluorophenyl]methoxy]-1,1-dihydroxy-3-methylideneisoindol-2-yl]-3,3,4,4,5-pentahydroxy-6-methylidenepiperidin-2-one.
| Compound Name | 5-[7-[[3-[(3,5-dimethylpiperidin-1-yl)methyl]-2-fluorophenyl]methoxy]-1,1-dihydroxy-3-methylideneisoindol-2-yl]-3,3,4,4,5-pentahydroxy-6-methylidenepiperidin-2-one |
|---|---|
| PubChem CID | 145070821 |
| Molecular Formula | C30H36FN3O9 |
| Molecular Weight | 601.63 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | 5-[7-[[3-[(3,5-dimethylpiperidin-1-yl)methyl]-2-fluorophenyl]methoxy]-1,1-dihydroxy-3-methylideneisoindol-2-yl]-3,3,4,4,5-pentahydroxy-6-methylidenepiperidin-2-one |
| SMILES | C=C1c2cccc(OCc3cccc(CN4CC(C)CC(C)C4)c3F)c2C(O)(O)N1C1(O)C(=C)NC(=O)C(O)(O)C1(O)O |
| InChI | InChI=1S/C30H36FN3O9/c1-16-11-17(2)13-33(12-16)14-20-7-5-8-21(25(20)31)15-43-23-10-6-9-22-18(3)34(29(39,40)24(22)23)27(36)19(4)32-26(35)28(37,38)30(27,41)42/h5-10,16-17,36-42H,3-4,11-15H2,1-2H3,(H,32,35) |
| InChIKey | DFRFTRLRCGLFTK-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 186.42 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.63 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|