C32H42FN3O5 — CID 145070858
N-[3-[[2-[[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-6-formylphenyl]methyl-methylamino]-3-hydroxyprop-1-en-2-yl]propanamide;prop-1-yne (PubChem CID 145070858) has the molecular formula C32H42FN3O5 and a molecular weight of 567.70 g/mol. Its IUPAC name is N-[3-[[2-[[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-6-formylphenyl]methyl-methylamino]-3-hydroxyprop-1-en-2-yl]propanamide;prop-1-yne.
| Compound Name | N-[3-[[2-[[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-6-formylphenyl]methyl-methylamino]-3-hydroxyprop-1-en-2-yl]propanamide;prop-1-yne |
|---|---|
| PubChem CID | 145070858 |
| Molecular Formula | C32H42FN3O5 |
| Molecular Weight | 567.70 g/mol |
| Exact Mass | 567.31 |
| IUPAC Name | N-[3-[[2-[[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-6-formylphenyl]methyl-methylamino]-3-hydroxyprop-1-en-2-yl]propanamide;prop-1-yne |
| SMILES | C#CC.C=C(NC(=O)CC)C(O)N(C)Cc1c(C=O)cccc1OCc1cccc(CN2CC(C)OC(C)C2)c1F |
| InChI | InChI=1S/C29H38FN3O5.C3H4/c1-6-27(35)31-21(4)29(36)32(5)16-25-23(17-34)10-8-12-26(25)37-18-24-11-7-9-22(28(24)30)15-33-13-19(2)38-20(3)14-33;1-3-2/h7-12,17,19-20,29,36H,4,6,13-16,18H2,1-3,5H3,(H,31,35);1H,2H3 |
| InChIKey | SLXIWLJRWRYUPP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.70 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|