C28H34FN3O6 — CID 145071027
2-[7-[[[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]-dihydroxymethyl]amino]-3-oxo-1H-isoindol-2-yl]-2-hydroxyhex-5-enal (PubChem CID 145071027) has the molecular formula C28H34FN3O6 and a molecular weight of 527.59 g/mol. Its IUPAC name is 2-[7-[[[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]-dihydroxymethyl]amino]-3-oxo-1H-isoindol-2-yl]-2-hydroxyhex-5-enal.
| Compound Name | 2-[7-[[[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]-dihydroxymethyl]amino]-3-oxo-1H-isoindol-2-yl]-2-hydroxyhex-5-enal |
|---|---|
| PubChem CID | 145071027 |
| Molecular Formula | C28H34FN3O6 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 2-[7-[[[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]-dihydroxymethyl]amino]-3-oxo-1H-isoindol-2-yl]-2-hydroxyhex-5-enal |
| SMILES | C=CCCC(O)(C=O)N1Cc2c(NC(O)(O)c3cccc(CN4CC(C)OC(C)C4)c3F)cccc2C1=O |
| InChI | InChI=1S/C28H34FN3O6/c1-4-5-12-27(35,17-33)32-16-22-21(26(32)34)9-7-11-24(22)30-28(36,37)23-10-6-8-20(25(23)29)15-31-13-18(2)38-19(3)14-31/h4,6-11,17-19,30,35-37H,1,5,12-16H2,2-3H3 |
| InChIKey | FSWDAOWJSLUDDS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 122.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|