C21H23ClO2 — CID 145071157
3-[(2Z,4Z)-5-chlorohepta-2,4-dien-4-yl]-9-methoxy-2,3-dihydro-1H-benzo[f]chromene (PubChem CID 145071157) has the molecular formula C21H23ClO2 and a molecular weight of 342.87 g/mol. Its IUPAC name is 3-[(2Z,4Z)-5-chlorohepta-2,4-dien-4-yl]-9-methoxy-2,3-dihydro-1H-benzo[f]chromene.
| Compound Name | 3-[(2Z,4Z)-5-chlorohepta-2,4-dien-4-yl]-9-methoxy-2,3-dihydro-1H-benzo[f]chromene |
|---|---|
| PubChem CID | 145071157 |
| Molecular Formula | C21H23ClO2 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 3-[(2Z,4Z)-5-chlorohepta-2,4-dien-4-yl]-9-methoxy-2,3-dihydro-1H-benzo[f]chromene |
| SMILES | C/C=C\C(=C(\Cl)CC)C1CCc2c(ccc3ccc(OC)cc23)O1 |
| InChI | InChI=1S/C21H23ClO2/c1-4-6-17(19(22)5-2)21-12-10-16-18-13-15(23-3)9-7-14(18)8-11-20(16)24-21/h4,6-9,11,13,21H,5,10,12H2,1-3H3/b6-4-,19-17- |
| InChIKey | OBVGWRFNKVSPGF-HQXVDDKPSA-N |
| XLogP | 6.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|