C21H24N4O2 — CID 145071590
2-benzyl-4-[[(3E)-2-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dienyl]amino]-5-methanimidoyl-1H-pyrimidin-6-one (PubChem CID 145071590) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-benzyl-4-[[(3E)-2-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dienyl]amino]-5-methanimidoyl-1H-pyrimidin-6-one.
| Compound Name | 2-benzyl-4-[[(3E)-2-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dienyl]amino]-5-methanimidoyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 145071590 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-benzyl-4-[[(3E)-2-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dienyl]amino]-5-methanimidoyl-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1c(NCC(O)C(/C=C\C)=C/C=C)nc(Cc2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C21H24N4O2/c1-3-8-16(9-4-2)18(26)14-23-20-17(13-22)21(27)25-19(24-20)12-15-10-6-5-7-11-15/h3-11,13,18,22,26H,1,12,14H2,2H3,(H2,23,24,25,27)/b9-4-,16-8+,22-13+ |
| InChIKey | DUPNXIUUTRQNQJ-JBWFDJSQSA-N |
| XLogP | 2.82 |
| TPSA | 101.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|