C24H25N4O2S — CID 145071725
CID 145071725 (PubChem CID 145071725) has the molecular formula C24H25N4O2S and a molecular weight of 433.56 g/mol.
| Compound Name | CID 145071725 |
|---|---|
| PubChem CID | 145071725 |
| Molecular Formula | C24H25N4O2S |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | — |
| SMILES | COc1cccc(Cn2cnc3sc4c(c3c2=O)CCC(NCC2=C[CH]NC=C2)C4)c1 |
| InChI | InChI=1S/C24H25N4O2S/c1-30-19-4-2-3-17(11-19)14-28-15-27-23-22(24(28)29)20-6-5-18(12-21(20)31-23)26-13-16-7-9-25-10-8-16/h2-4,7-11,15,18,25-26H,5-6,12-14H2,1H3 |
| InChIKey | GHXBGAYHXRSHDK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |