C30H32F3N5OS — CID 145071955
5-[3-[[5-[6-[(3E)-hexa-1,3,5-trien-3-yl]oxy-3-pyridinyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-2-[4-(trifluoromethyl)phenyl]-5-azaspiro[2.4]heptane (PubChem CID 145071955) has the molecular formula C30H32F3N5OS and a molecular weight of 567.68 g/mol. Its IUPAC name is 5-[3-[[5-[6-[(3E)-hexa-1,3,5-trien-3-yl]oxy-3-pyridinyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-2-[4-(trifluoromethyl)phenyl]-5-azaspiro[2.4]heptane.
| Compound Name | 5-[3-[[5-[6-[(3E)-hexa-1,3,5-trien-3-yl]oxy-3-pyridinyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-2-[4-(trifluoromethyl)phenyl]-5-azaspiro[2.4]heptane |
|---|---|
| PubChem CID | 145071955 |
| Molecular Formula | C30H32F3N5OS |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | 5-[3-[[5-[6-[(3E)-hexa-1,3,5-trien-3-yl]oxy-3-pyridinyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-2-[4-(trifluoromethyl)phenyl]-5-azaspiro[2.4]heptane |
| SMILES | C=C/C=C(\C=C)Oc1ccc(-c2nnc(SCCCN3CCC4(CC4c4ccc(C(F)(F)F)cc4)C3)n2C)cn1 |
| InChI | InChI=1S/C30H32F3N5OS/c1-4-7-24(5-2)39-26-13-10-22(19-34-26)27-35-36-28(37(27)3)40-17-6-15-38-16-14-29(20-38)18-25(29)21-8-11-23(12-9-21)30(31,32)33/h4-5,7-13,19,25H,1-2,6,14-18,20H2,3H3/b24-7+ |
| InChIKey | CDLFJDJQAABGNM-HCBMXOAHSA-N |
| XLogP | 6.89 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|