C25H33N5 — CID 145072042
(1Z,3E)-3-[(5S)-6-ethyl-5,7-dimethyl-6,6a-dihydro-5H-purino[7,8-a]quinolin-9-yl]-4,5-dimethylhexa-1,3-dien-1-amine (PubChem CID 145072042) has the molecular formula C25H33N5 and a molecular weight of 403.57 g/mol. Its IUPAC name is (1Z,3E)-3-[(5S)-6-ethyl-5,7-dimethyl-6,6a-dihydro-5H-purino[7,8-a]quinolin-9-yl]-4,5-dimethylhexa-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-3-[(5S)-6-ethyl-5,7-dimethyl-6,6a-dihydro-5H-purino[7,8-a]quinolin-9-yl]-4,5-dimethylhexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 145072042 |
| Molecular Formula | C25H33N5 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | (1Z,3E)-3-[(5S)-6-ethyl-5,7-dimethyl-6,6a-dihydro-5H-purino[7,8-a]quinolin-9-yl]-4,5-dimethylhexa-1,3-dien-1-amine |
| SMILES | CCC1C2N(C)c3nc(C(/C=C\N)=C(\C)C(C)C)ncc3N2c2ccccc2[C@H]1C |
| InChI | InChI=1S/C25H33N5/c1-7-18-17(5)19-10-8-9-11-21(19)30-22-14-27-23(28-24(22)29(6)25(18)30)20(12-13-26)16(4)15(2)3/h8-15,17-18,25H,7,26H2,1-6H3/b13-12-,20-16+/t17-,18?,25?/m0/s1 |
| InChIKey | LUDTUYFHZKXXOE-ZBCLLUSRSA-N |
| XLogP | 5.44 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|