About 2-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]ethanol;ethane
2-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]ethanol;ethane (PubChem CID 145072130) has the molecular formula C7H17N5O
and a molecular weight of 187.25 g/mol. Its IUPAC name is 2-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]ethanol;ethane.
Molecular Properties
| Compound Name | 2-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]ethanol;ethane |
| PubChem CID | 145072130 |
| Molecular Formula | C7H17N5O |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]ethanol;ethane |
| SMILES | CC.Cn1nc(N)nc1NCCO |
| InChI | InChI=1S/C5H11N5O.C2H6/c1-10-5(7-2-3-11)8-4(6)9-10;1-2/h11H,2-3H2,1H3,(H3,6,7,8,9);1-2H3 |
| InChIKey | HXUWGMIGLHDFSS-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]ethanol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]ethanol;ethane?
The IUPAC name of 2-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]ethanol;ethane (CID 145072130) is 2-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]ethanol;ethane.
What is the SMILES notation for 2-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]ethanol;ethane?
The canonical SMILES for 2-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]ethanol;ethane is CC.Cn1nc(N)nc1NCCO.
What is the InChIKey of 2-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]ethanol;ethane?
The InChIKey is HXUWGMIGLHDFSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N5O.C2H6/c1-10-5(7-2-3-11)8-4(6)9-10;1-2/h11H,2-3H2,1H3,(H3,6,7,8,9);1-2H3.
What are the key properties of 2-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]ethanol;ethane?
2-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]ethanol;ethane has a molecular weight of 187.25 g/mol, XLogP of -0.17, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]ethanol;ethane is sourced from PubChem (CID 145072130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).