About 6-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile
6-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile (PubChem CID 1450725) has the molecular formula C17H15N3O4S
and a molecular weight of 357.39 g/mol. Its IUPAC name is 6-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile.
Molecular Properties
| Compound Name | 6-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile |
| PubChem CID | 1450725 |
| Molecular Formula | C17H15N3O4S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 6-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile |
| SMILES | N#Cc1cc2cc3c(cc2nc1SCC(=O)N1CCOCC1)OCO3 |
| InChI | InChI=1S/C17H15N3O4S/c18-8-12-5-11-6-14-15(24-10-23-14)7-13(11)19-17(12)25-9-16(21)20-1-3-22-4-2-20/h5-7H,1-4,9-10H2 |
| InChIKey | NBBPNOABAKNGMI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 84.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile?
The IUPAC name of 6-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile (CID 1450725) is 6-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile.
What is the SMILES notation for 6-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile?
The canonical SMILES for 6-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile is N#Cc1cc2cc3c(cc2nc1SCC(=O)N1CCOCC1)OCO3.
What is the InChIKey of 6-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile?
The InChIKey is NBBPNOABAKNGMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O4S/c18-8-12-5-11-6-14-15(24-10-23-14)7-13(11)19-17(12)25-9-16(21)20-1-3-22-4-2-20/h5-7H,1-4,9-10H2.
What are the key properties of 6-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile?
6-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile has a molecular weight of 357.39 g/mol, XLogP of 1.79, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile is sourced from PubChem (CID 1450725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).