C19H17ClF2N4O3S — CID 145072508
(3R,6aS)-6-[[6-chloro-5-[(2,6-difluorophenyl)methylamino]-1H-imidazo[4,5-b]pyridin-2-yl]sulfanyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 145072508) has the molecular formula C19H17ClF2N4O3S and a molecular weight of 454.89 g/mol. Its IUPAC name is (3R,6aS)-6-[[6-chloro-5-[(2,6-difluorophenyl)methylamino]-1H-imidazo[4,5-b]pyridin-2-yl]sulfanyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,6aS)-6-[[6-chloro-5-[(2,6-difluorophenyl)methylamino]-1H-imidazo[4,5-b]pyridin-2-yl]sulfanyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 145072508 |
| Molecular Formula | C19H17ClF2N4O3S |
| Molecular Weight | 454.89 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | (3R,6aS)-6-[[6-chloro-5-[(2,6-difluorophenyl)methylamino]-1H-imidazo[4,5-b]pyridin-2-yl]sulfanyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@@H]2C(Sc3nc4nc(NCc5c(F)cccc5F)c(Cl)cc4[nH]3)COC21 |
| InChI | InChI=1S/C19H17ClF2N4O3S/c20-9-4-12-18(25-17(9)23-5-8-10(21)2-1-3-11(8)22)26-19(24-12)30-14-7-29-15-13(27)6-28-16(14)15/h1-4,13-16,27H,5-7H2,(H2,23,24,25,26)/t13-,14?,15?,16-/m1/s1 |
| InChIKey | SOSLQMKYMJXRHL-PRLABOORSA-N |
| XLogP | 3.12 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.89 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |