C27H12Br2F6N2 — CID 145072708
5,10-dibromo-1,1,2,2,3,3-hexafluoro-4,11-diphenylcyclopenta[f][1,10]phenanthroline (PubChem CID 145072708) has the molecular formula C27H12Br2F6N2 and a molecular weight of 638.20 g/mol. Its IUPAC name is 5,10-dibromo-1,1,2,2,3,3-hexafluoro-4,11-diphenylcyclopenta[f][1,10]phenanthroline.
| Compound Name | 5,10-dibromo-1,1,2,2,3,3-hexafluoro-4,11-diphenylcyclopenta[f][1,10]phenanthroline |
|---|---|
| PubChem CID | 145072708 |
| Molecular Formula | C27H12Br2F6N2 |
| Molecular Weight | 638.20 g/mol |
| Exact Mass | 635.93 |
| IUPAC Name | 5,10-dibromo-1,1,2,2,3,3-hexafluoro-4,11-diphenylcyclopenta[f][1,10]phenanthroline |
| SMILES | FC1(F)c2c(c3c(-c4ccccc4)c(Br)cnc3c3ncc(Br)c(-c4ccccc4)c23)C(F)(F)C1(F)F |
| InChI | InChI=1S/C27H12Br2F6N2/c28-15-11-36-23-19(17(15)13-7-3-1-4-8-13)21-22(26(32,33)27(34,35)25(21,30)31)20-18(14-9-5-2-6-10-14)16(29)12-37-24(20)23/h1-12H |
| InChIKey | KQWVTGZTPFGUPG-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.20 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|