C40H40BN3O2 — CID 145073019
N'-[C-phenyl-N-(1-phenylethyl)carbonimidoyl]-3-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]benzenecarboximidamide (PubChem CID 145073019) has the molecular formula C40H40BN3O2 and a molecular weight of 605.59 g/mol. Its IUPAC name is N'-[C-phenyl-N-(1-phenylethyl)carbonimidoyl]-3-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]benzenecarboximidamide.
| Compound Name | N'-[C-phenyl-N-(1-phenylethyl)carbonimidoyl]-3-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145073019 |
| Molecular Formula | C40H40BN3O2 |
| Molecular Weight | 605.59 g/mol |
| Exact Mass | 605.32 |
| IUPAC Name | N'-[C-phenyl-N-(1-phenylethyl)carbonimidoyl]-3-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]benzenecarboximidamide |
| SMILES | CC(/N=C(/N=C(\N)c1cccc(-c2cccc(-c3cccc(B4OC(C)(C)C(C)(C)O4)c3)c2)c1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H40BN3O2/c1-28(29-15-8-6-9-16-29)43-38(30-17-10-7-11-18-30)44-37(42)35-23-13-21-33(26-35)31-19-12-20-32(25-31)34-22-14-24-36(27-34)41-45-39(2,3)40(4,5)46-41/h6-28H,1-5H3,(H2,42,43,44) |
| InChIKey | NEKMVIORURWLEW-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.59 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|