C43H51N — CID 145073450
(E)-3-cyclohexa-1,5-dien-1-yl-3-[4-[1-[4-[(2Z)-hepta-2,6-dienyl]phenyl]cyclohexyl]phenyl]-N-methyl-1-phenylprop-2-en-1-imine;ethane (PubChem CID 145073450) has the molecular formula C43H51N and a molecular weight of 581.89 g/mol. Its IUPAC name is (E)-3-cyclohexa-1,5-dien-1-yl-3-[4-[1-[4-[(2Z)-hepta-2,6-dienyl]phenyl]cyclohexyl]phenyl]-N-methyl-1-phenylprop-2-en-1-imine;ethane.
| Compound Name | (E)-3-cyclohexa-1,5-dien-1-yl-3-[4-[1-[4-[(2Z)-hepta-2,6-dienyl]phenyl]cyclohexyl]phenyl]-N-methyl-1-phenylprop-2-en-1-imine;ethane |
|---|---|
| PubChem CID | 145073450 |
| Molecular Formula | C43H51N |
| Molecular Weight | 581.89 g/mol |
| Exact Mass | 581.40 |
| IUPAC Name | (E)-3-cyclohexa-1,5-dien-1-yl-3-[4-[1-[4-[(2Z)-hepta-2,6-dienyl]phenyl]cyclohexyl]phenyl]-N-methyl-1-phenylprop-2-en-1-imine;ethane |
| SMILES | C=CCC/C=C\Cc1ccc(C2(c3ccc(/C(=C/C(=N/C)c4ccccc4)C4=CCCC=C4)cc3)CCCCC2)cc1.CC |
| InChI | InChI=1S/C41H45N.C2H6/c1-3-4-5-6-10-17-33-22-26-37(27-23-33)41(30-15-9-16-31-41)38-28-24-35(25-29-38)39(34-18-11-7-12-19-34)32-40(42-2)36-20-13-8-14-21-36;1-2/h3,6,8,10-11,13-14,18-29,32H,1,4-5,7,9,12,15-17,30-31H2,2H3;1-2H3/b10-6-,39-32+,42-40-; |
| InChIKey | ZTUGSQIKAOXQFH-XDJBCRGLSA-N |
| XLogP | 11.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.89 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|