C26H24BN3O2 — CID 145073841
8-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,12,14,16-octaene (PubChem CID 145073841) has the molecular formula C26H24BN3O2 and a molecular weight of 421.31 g/mol. Its IUPAC name is 8-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,12,14,16-octaene.
| Compound Name | 8-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,12,14,16-octaene |
|---|---|
| PubChem CID | 145073841 |
| Molecular Formula | C26H24BN3O2 |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 8-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,12,14,16-octaene |
| SMILES | CC1(C)OB(c2ccc3c(c2)c(-c2ccccc2)nc2c3nc3ccccn32)OC1(C)C |
| InChI | InChI=1S/C26H24BN3O2/c1-25(2)26(3,4)32-27(31-25)18-13-14-19-20(16-18)22(17-10-6-5-7-11-17)29-24-23(19)28-21-12-8-9-15-30(21)24/h5-16H,1-4H3 |
| InChIKey | FVZNUOJQSFSGRN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|