C31H38BN3O2 — CID 145073872
ethane;8-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene (PubChem CID 145073872) has the molecular formula C31H38BN3O2 and a molecular weight of 495.48 g/mol. Its IUPAC name is ethane;8-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene.
| Compound Name | ethane;8-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
|---|---|
| PubChem CID | 145073872 |
| Molecular Formula | C31H38BN3O2 |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | ethane;8-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
| SMILES | CC.CC.Cc1cc(-c2nc3c(nc4ccccn43)c3ccccc23)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C27H26BN3O2.2C2H6/c1-17-16-18(13-14-21(17)28-32-26(2,3)27(4,5)33-28)23-19-10-6-7-11-20(19)24-25(30-23)31-15-9-8-12-22(31)29-24;2*1-2/h6-16H,1-5H3;2*1-2H3 |
| InChIKey | NOVVASKQSMMTCV-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|