C18H18F3N3O4S — CID 145074126
2,2-dimethyl-5-[[[(Z)-1-(2-methylidenehydrazinyl)-3-[3-(trifluoromethylsulfanyl)phenyl]prop-1-enyl]amino]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 145074126) has the molecular formula C18H18F3N3O4S and a molecular weight of 429.42 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[[(Z)-1-(2-methylidenehydrazinyl)-3-[3-(trifluoromethylsulfanyl)phenyl]prop-1-enyl]amino]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[[(Z)-1-(2-methylidenehydrazinyl)-3-[3-(trifluoromethylsulfanyl)phenyl]prop-1-enyl]amino]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 145074126 |
| Molecular Formula | C18H18F3N3O4S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 2,2-dimethyl-5-[[[(Z)-1-(2-methylidenehydrazinyl)-3-[3-(trifluoromethylsulfanyl)phenyl]prop-1-enyl]amino]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | C=NN/C(=C\Cc1cccc(SC(F)(F)F)c1)NC=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C18H18F3N3O4S/c1-17(2)27-15(25)13(16(26)28-17)10-23-14(24-22-3)8-7-11-5-4-6-12(9-11)29-18(19,20)21/h4-6,8-10,23-24H,3,7H2,1-2H3/b14-8- |
| InChIKey | KODPNZCULINOES-ZSOIEALJSA-N |
| XLogP | 3.20 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|