C19H20N6O2 — CID 145074287
1-[(6R)-6-methyl-1-[2-(triazol-2-yl)benzoyl]piperidin-3-yl]pyrazole-4-carbaldehyde (PubChem CID 145074287) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 1-[(6R)-6-methyl-1-[2-(triazol-2-yl)benzoyl]piperidin-3-yl]pyrazole-4-carbaldehyde.
| Compound Name | 1-[(6R)-6-methyl-1-[2-(triazol-2-yl)benzoyl]piperidin-3-yl]pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 145074287 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-[(6R)-6-methyl-1-[2-(triazol-2-yl)benzoyl]piperidin-3-yl]pyrazole-4-carbaldehyde |
| SMILES | C[C@@H]1CCC(n2cc(C=O)cn2)CN1C(=O)c1ccccc1-n1nccn1 |
| InChI | InChI=1S/C19H20N6O2/c1-14-6-7-16(24-11-15(13-26)10-22-24)12-23(14)19(27)17-4-2-3-5-18(17)25-20-8-9-21-25/h2-5,8-11,13-14,16H,6-7,12H2,1H3/t14-,16?/m1/s1 |
| InChIKey | IAWXOZXVEWBBIJ-IURRXHLWSA-N |
| XLogP | 2.14 |
| TPSA | 85.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|