About 3-(dibutylamino)propanamide;ethane;prop-2-enoic acid
3-(dibutylamino)propanamide;ethane;prop-2-enoic acid (PubChem CID 145074740) has the molecular formula C16H34N2O3
and a molecular weight of 302.46 g/mol. Its IUPAC name is 3-(dibutylamino)propanamide;ethane;prop-2-enoic acid.
Molecular Properties
| Compound Name | 3-(dibutylamino)propanamide;ethane;prop-2-enoic acid |
| PubChem CID | 145074740 |
| Molecular Formula | C16H34N2O3 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | 3-(dibutylamino)propanamide;ethane;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CC.CCCCN(CCCC)CCC(N)=O |
| InChI | InChI=1S/C11H24N2O.C3H4O2.C2H6/c1-3-5-8-13(9-6-4-2)10-7-11(12)14;1-2-3(4)5;1-2/h3-10H2,1-2H3,(H2,12,14);2H,1H2,(H,4,5);1-2H3 |
| InChIKey | OLFXFAOOQNDGRE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(dibutylamino)propanamide;ethane;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dibutylamino)propanamide;ethane;prop-2-enoic acid?
The IUPAC name of 3-(dibutylamino)propanamide;ethane;prop-2-enoic acid (CID 145074740) is 3-(dibutylamino)propanamide;ethane;prop-2-enoic acid.
What is the SMILES notation for 3-(dibutylamino)propanamide;ethane;prop-2-enoic acid?
The canonical SMILES for 3-(dibutylamino)propanamide;ethane;prop-2-enoic acid is C=CC(=O)O.CC.CCCCN(CCCC)CCC(N)=O.
What is the InChIKey of 3-(dibutylamino)propanamide;ethane;prop-2-enoic acid?
The InChIKey is OLFXFAOOQNDGRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O.C3H4O2.C2H6/c1-3-5-8-13(9-6-4-2)10-7-11(12)14;1-2-3(4)5;1-2/h3-10H2,1-2H3,(H2,12,14);2H,1H2,(H,4,5);1-2H3.
What are the key properties of 3-(dibutylamino)propanamide;ethane;prop-2-enoic acid?
3-(dibutylamino)propanamide;ethane;prop-2-enoic acid has a molecular weight of 302.46 g/mol, XLogP of 3.05, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dibutylamino)propanamide;ethane;prop-2-enoic acid is sourced from PubChem (CID 145074740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).