C10H18N2 — CID 145074816
(Z)-3,4-diethylhex-3-ene-2,5-diimine (PubChem CID 145074816) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (Z)-3,4-diethylhex-3-ene-2,5-diimine.
| Compound Name | (Z)-3,4-diethylhex-3-ene-2,5-diimine |
|---|---|
| PubChem CID | 145074816 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (Z)-3,4-diethylhex-3-ene-2,5-diimine |
| SMILES | [H]/N=C(C)/C(CC)=C(CC)\C(C)=N\[H] |
| InChI | InChI=1S/C10H18N2/c1-5-9(7(3)11)10(6-2)8(4)12/h11-12H,5-6H2,1-4H3/b10-9-,11-7+,12-8+ |
| InChIKey | MVRQDTFDFNDFNH-GJXBOELXSA-N |
| XLogP | 3.18 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|