C14H16ClF2N5O2 — CID 145075298
2-[3-(4-chlorophenyl)-4-(3,3-difluorobutyl)-5-oxo-1,2,4-triazol-1-yl]acetohydrazide (PubChem CID 145075298) has the molecular formula C14H16ClF2N5O2 and a molecular weight of 359.76 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-4-(3,3-difluorobutyl)-5-oxo-1,2,4-triazol-1-yl]acetohydrazide.
| Compound Name | 2-[3-(4-chlorophenyl)-4-(3,3-difluorobutyl)-5-oxo-1,2,4-triazol-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 145075298 |
| Molecular Formula | C14H16ClF2N5O2 |
| Molecular Weight | 359.76 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-4-(3,3-difluorobutyl)-5-oxo-1,2,4-triazol-1-yl]acetohydrazide |
| SMILES | CC(F)(F)CCn1c(-c2ccc(Cl)cc2)nn(CC(=O)NN)c1=O |
| InChI | InChI=1S/C14H16ClF2N5O2/c1-14(16,17)6-7-21-12(9-2-4-10(15)5-3-9)20-22(13(21)24)8-11(23)19-18/h2-5H,6-8,18H2,1H3,(H,19,23) |
| InChIKey | PRBSEUCPPSXPGU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.76 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|