About 2-methanimidoyl-3-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]aniline
2-methanimidoyl-3-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]aniline (PubChem CID 145075865) has the molecular formula C13H17F3N4O2S
and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-methanimidoyl-3-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]aniline.
Molecular Properties
| Compound Name | 2-methanimidoyl-3-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]aniline |
| PubChem CID | 145075865 |
| Molecular Formula | C13H17F3N4O2S |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-methanimidoyl-3-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]aniline |
| SMILES | [H]/N=C/c1c(N)cccc1N1CCN(S(=O)(=O)CC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H17F3N4O2S/c14-13(15,16)9-23(21,22)20-6-4-19(5-7-20)12-3-1-2-11(18)10(12)8-17/h1-3,8,17H,4-7,9,18H2/b17-8+ |
| InChIKey | NGNWDJNUELRDAI-CAOOACKPSA-N |
| XLogP | 1.28 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methanimidoyl-3-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanimidoyl-3-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]aniline?
The IUPAC name of 2-methanimidoyl-3-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]aniline (CID 145075865) is 2-methanimidoyl-3-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]aniline.
What is the SMILES notation for 2-methanimidoyl-3-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]aniline?
The canonical SMILES for 2-methanimidoyl-3-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]aniline is [H]/N=C/c1c(N)cccc1N1CCN(S(=O)(=O)CC(F)(F)F)CC1.
What is the InChIKey of 2-methanimidoyl-3-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]aniline?
The InChIKey is NGNWDJNUELRDAI-CAOOACKPSA-N. The full InChI is InChI=1S/C13H17F3N4O2S/c14-13(15,16)9-23(21,22)20-6-4-19(5-7-20)12-3-1-2-11(18)10(12)8-17/h1-3,8,17H,4-7,9,18H2/b17-8+.
What are the key properties of 2-methanimidoyl-3-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]aniline?
2-methanimidoyl-3-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]aniline has a molecular weight of 350.37 g/mol, XLogP of 1.28, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanimidoyl-3-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]aniline is sourced from PubChem (CID 145075865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).