C15H23ClN2O2 — CID 145076075
4-[(1E,3E)-3-chloro-4-(4-methyl-1H-pyrazol-5-yl)buta-1,3-dienyl]oxan-4-ol;ethane (PubChem CID 145076075) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is 4-[(1E,3E)-3-chloro-4-(4-methyl-1H-pyrazol-5-yl)buta-1,3-dienyl]oxan-4-ol;ethane.
| Compound Name | 4-[(1E,3E)-3-chloro-4-(4-methyl-1H-pyrazol-5-yl)buta-1,3-dienyl]oxan-4-ol;ethane |
|---|---|
| PubChem CID | 145076075 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 4-[(1E,3E)-3-chloro-4-(4-methyl-1H-pyrazol-5-yl)buta-1,3-dienyl]oxan-4-ol;ethane |
| SMILES | CC.Cc1cn[nH]c1/C=C(Cl)\C=C\C1(O)CCOCC1 |
| InChI | InChI=1S/C13H17ClN2O2.C2H6/c1-10-9-15-16-12(10)8-11(14)2-3-13(17)4-6-18-7-5-13;1-2/h2-3,8-9,17H,4-7H2,1H3,(H,15,16);1-2H3/b3-2+,11-8+; |
| InChIKey | HXFRXGRNFTYWSF-BGNHNGDKSA-N |
| XLogP | 3.42 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|