About 6-ethyl-4-(1-methylsulfonylpiperidin-4-yl)-7,7a-dihydro-1H-indazole
6-ethyl-4-(1-methylsulfonylpiperidin-4-yl)-7,7a-dihydro-1H-indazole (PubChem CID 145076162) has the molecular formula C15H23N3O2S
and a molecular weight of 309.44 g/mol. Its IUPAC name is 6-ethyl-4-(1-methylsulfonylpiperidin-4-yl)-7,7a-dihydro-1H-indazole.
Molecular Properties
| Compound Name | 6-ethyl-4-(1-methylsulfonylpiperidin-4-yl)-7,7a-dihydro-1H-indazole |
| PubChem CID | 145076162 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 6-ethyl-4-(1-methylsulfonylpiperidin-4-yl)-7,7a-dihydro-1H-indazole |
| SMILES | CCC1=CC(C2CCN(S(C)(=O)=O)CC2)=C2C=NNC2C1 |
| InChI | InChI=1S/C15H23N3O2S/c1-3-11-8-13(14-10-16-17-15(14)9-11)12-4-6-18(7-5-12)21(2,19)20/h8,10,12,15,17H,3-7,9H2,1-2H3 |
| InChIKey | DWGWMPGRCFYYOU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-ethyl-4-(1-methylsulfonylpiperidin-4-yl)-7,7a-dihydro-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-4-(1-methylsulfonylpiperidin-4-yl)-7,7a-dihydro-1H-indazole?
The IUPAC name of 6-ethyl-4-(1-methylsulfonylpiperidin-4-yl)-7,7a-dihydro-1H-indazole (CID 145076162) is 6-ethyl-4-(1-methylsulfonylpiperidin-4-yl)-7,7a-dihydro-1H-indazole.
What is the SMILES notation for 6-ethyl-4-(1-methylsulfonylpiperidin-4-yl)-7,7a-dihydro-1H-indazole?
The canonical SMILES for 6-ethyl-4-(1-methylsulfonylpiperidin-4-yl)-7,7a-dihydro-1H-indazole is CCC1=CC(C2CCN(S(C)(=O)=O)CC2)=C2C=NNC2C1.
What is the InChIKey of 6-ethyl-4-(1-methylsulfonylpiperidin-4-yl)-7,7a-dihydro-1H-indazole?
The InChIKey is DWGWMPGRCFYYOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O2S/c1-3-11-8-13(14-10-16-17-15(14)9-11)12-4-6-18(7-5-12)21(2,19)20/h8,10,12,15,17H,3-7,9H2,1-2H3.
What are the key properties of 6-ethyl-4-(1-methylsulfonylpiperidin-4-yl)-7,7a-dihydro-1H-indazole?
6-ethyl-4-(1-methylsulfonylpiperidin-4-yl)-7,7a-dihydro-1H-indazole has a molecular weight of 309.44 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-4-(1-methylsulfonylpiperidin-4-yl)-7,7a-dihydro-1H-indazole is sourced from PubChem (CID 145076162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).