C22H34ClN3O — CID 145076232
1-[(3Z,5E)-2-amino-6-chloro-3-methanimidoylhepta-1,3,5-trien-4-yl]-4-[(2E)-nona-2,6-dien-3-yl]piperidin-4-ol (PubChem CID 145076232) has the molecular formula C22H34ClN3O and a molecular weight of 391.99 g/mol. Its IUPAC name is 1-[(3Z,5E)-2-amino-6-chloro-3-methanimidoylhepta-1,3,5-trien-4-yl]-4-[(2E)-nona-2,6-dien-3-yl]piperidin-4-ol.
| Compound Name | 1-[(3Z,5E)-2-amino-6-chloro-3-methanimidoylhepta-1,3,5-trien-4-yl]-4-[(2E)-nona-2,6-dien-3-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 145076232 |
| Molecular Formula | C22H34ClN3O |
| Molecular Weight | 391.99 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 1-[(3Z,5E)-2-amino-6-chloro-3-methanimidoylhepta-1,3,5-trien-4-yl]-4-[(2E)-nona-2,6-dien-3-yl]piperidin-4-ol |
| SMILES | [H]/N=C/C(C(=C)N)=C(/C=C(\C)Cl)N1CCC(O)(/C(=C/C)CCC=CCC)CC1 |
| InChI | InChI=1S/C22H34ClN3O/c1-5-7-8-9-10-19(6-2)22(27)11-13-26(14-12-22)21(15-17(3)23)20(16-24)18(4)25/h6-8,15-16,24,27H,4-5,9-14,25H2,1-3H3/b8-7?,17-15+,19-6+,21-20+,24-16+ |
| InChIKey | RHAKDDIASCCDRZ-NTVIZAADSA-N |
| XLogP | 5.02 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.99 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|