C9H15ClN2 — CID 145076266
1-(3-chloro-2,4,5-trimethyl-2,5-dihydropyrrol-1-yl)ethanimine (PubChem CID 145076266) has the molecular formula C9H15ClN2 and a molecular weight of 186.69 g/mol. Its IUPAC name is 1-(3-chloro-2,4,5-trimethyl-2,5-dihydropyrrol-1-yl)ethanimine.
| Compound Name | 1-(3-chloro-2,4,5-trimethyl-2,5-dihydropyrrol-1-yl)ethanimine |
|---|---|
| PubChem CID | 145076266 |
| Molecular Formula | C9H15ClN2 |
| Molecular Weight | 186.69 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1-(3-chloro-2,4,5-trimethyl-2,5-dihydropyrrol-1-yl)ethanimine |
| SMILES | [H]/N=C(\C)N1C(C)C(C)=C(Cl)C1C |
| InChI | InChI=1S/C9H15ClN2/c1-5-6(2)12(8(4)11)7(3)9(5)10/h6-7,11H,1-4H3/b11-8+ |
| InChIKey | WBEIEIPIFCXQBR-DHZHZOJOSA-N |
| XLogP | 2.59 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.69 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|