C15H25N3O3 — CID 145076354
4-(2,5-dioxopyrrol-1-yl)-2,2,4-trimethyl-N'-propylpentanehydrazide (PubChem CID 145076354) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)-2,2,4-trimethyl-N'-propylpentanehydrazide.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)-2,2,4-trimethyl-N'-propylpentanehydrazide |
|---|---|
| PubChem CID | 145076354 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)-2,2,4-trimethyl-N'-propylpentanehydrazide |
| SMILES | CCCNNC(=O)C(C)(C)CC(C)(C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H25N3O3/c1-6-9-16-17-13(21)14(2,3)10-15(4,5)18-11(19)7-8-12(18)20/h7-8,16H,6,9-10H2,1-5H3,(H,17,21) |
| InChIKey | MIXIZAXTOWCMFU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|