C32H36N2O11 — CID 145076370
9-acetyl-4-amino-6,9,11-trihydroxy-7-[(10-methoxy-6-methyl-5,8,12-trioxa-1-azatricyclo[7.5.0.02,7]tetradecan-4-yl)oxy]-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 145076370) has the molecular formula C32H36N2O11 and a molecular weight of 624.64 g/mol. Its IUPAC name is 9-acetyl-4-amino-6,9,11-trihydroxy-7-[(10-methoxy-6-methyl-5,8,12-trioxa-1-azatricyclo[7.5.0.02,7]tetradecan-4-yl)oxy]-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | 9-acetyl-4-amino-6,9,11-trihydroxy-7-[(10-methoxy-6-methyl-5,8,12-trioxa-1-azatricyclo[7.5.0.02,7]tetradecan-4-yl)oxy]-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 145076370 |
| Molecular Formula | C32H36N2O11 |
| Molecular Weight | 624.64 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | 9-acetyl-4-amino-6,9,11-trihydroxy-7-[(10-methoxy-6-methyl-5,8,12-trioxa-1-azatricyclo[7.5.0.02,7]tetradecan-4-yl)oxy]-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COC1COCCN2C3CC(OC4CC(O)(C(C)=O)Cc5c(O)c6c(c(O)c54)C(=O)c4c(N)cccc4C6=O)OC(C)C3OC12 |
| InChI | InChI=1S/C32H36N2O11/c1-13-30-18(34-7-8-42-12-20(41-3)31(34)45-30)9-21(43-13)44-19-11-32(40,14(2)35)10-16-23(19)29(39)25-24(27(16)37)26(36)15-5-4-6-17(33)22(15)28(25)38/h4-6,13,18-21,30-31,37,39-40H,7-12,33H2,1-3H3 |
| InChIKey | PADRCJDZUGUFEP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 187.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.64 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|