C19H23F3N2O — CID 145076435
N-piperidin-4-yl-2-[(3Z)-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]cyclohexa-1,5-diene-1-carboxamide (PubChem CID 145076435) has the molecular formula C19H23F3N2O and a molecular weight of 352.40 g/mol. Its IUPAC name is N-piperidin-4-yl-2-[(3Z)-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | N-piperidin-4-yl-2-[(3Z)-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 145076435 |
| Molecular Formula | C19H23F3N2O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-piperidin-4-yl-2-[(3Z)-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]cyclohexa-1,5-diene-1-carboxamide |
| SMILES | C=C(/C=C\C(=C)C(F)(F)F)C1=C(C(=O)NC2CCNCC2)C=CCC1 |
| InChI | InChI=1S/C19H23F3N2O/c1-13(7-8-14(2)19(20,21)22)16-5-3-4-6-17(16)18(25)24-15-9-11-23-12-10-15/h4,6-8,15,23H,1-3,5,9-12H2,(H,24,25)/b8-7- |
| InChIKey | QUISISJOEPGJRB-FPLPWBNLSA-N |
| XLogP | 3.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|