About ethane;1-[(1-pentyltriazol-4-yl)methyl]pyrrole-2,5-dione
ethane;1-[(1-pentyltriazol-4-yl)methyl]pyrrole-2,5-dione (PubChem CID 145076451) has the molecular formula C16H28N4O2
and a molecular weight of 308.43 g/mol. Its IUPAC name is ethane;1-[(1-pentyltriazol-4-yl)methyl]pyrrole-2,5-dione.
Molecular Properties
| Compound Name | ethane;1-[(1-pentyltriazol-4-yl)methyl]pyrrole-2,5-dione |
| PubChem CID | 145076451 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | ethane;1-[(1-pentyltriazol-4-yl)methyl]pyrrole-2,5-dione |
| SMILES | CC.CC.CCCCCn1cc(CN2C(=O)C=CC2=O)nn1 |
| InChI | InChI=1S/C12H16N4O2.2C2H6/c1-2-3-4-7-15-8-10(13-14-15)9-16-11(17)5-6-12(16)18;2*1-2/h5-6,8H,2-4,7,9H2,1H3;2*1-2H3 |
| InChIKey | PGTUVRDPKBLSRQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[(1-pentyltriazol-4-yl)methyl]pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[(1-pentyltriazol-4-yl)methyl]pyrrole-2,5-dione?
The IUPAC name of ethane;1-[(1-pentyltriazol-4-yl)methyl]pyrrole-2,5-dione (CID 145076451) is ethane;1-[(1-pentyltriazol-4-yl)methyl]pyrrole-2,5-dione.
What is the SMILES notation for ethane;1-[(1-pentyltriazol-4-yl)methyl]pyrrole-2,5-dione?
The canonical SMILES for ethane;1-[(1-pentyltriazol-4-yl)methyl]pyrrole-2,5-dione is CC.CC.CCCCCn1cc(CN2C(=O)C=CC2=O)nn1.
What is the InChIKey of ethane;1-[(1-pentyltriazol-4-yl)methyl]pyrrole-2,5-dione?
The InChIKey is PGTUVRDPKBLSRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O2.2C2H6/c1-2-3-4-7-15-8-10(13-14-15)9-16-11(17)5-6-12(16)18;2*1-2/h5-6,8H,2-4,7,9H2,1H3;2*1-2H3.
What are the key properties of ethane;1-[(1-pentyltriazol-4-yl)methyl]pyrrole-2,5-dione?
ethane;1-[(1-pentyltriazol-4-yl)methyl]pyrrole-2,5-dione has a molecular weight of 308.43 g/mol, XLogP of 2.95, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[(1-pentyltriazol-4-yl)methyl]pyrrole-2,5-dione is sourced from PubChem (CID 145076451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).