C32H60N2O11 — CID 145076605
1,4-dimethylpiperidine;3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanal;ethane (PubChem CID 145076605) has the molecular formula C32H60N2O11 and a molecular weight of 648.84 g/mol. Its IUPAC name is 1,4-dimethylpiperidine;3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanal;ethane.
| Compound Name | 1,4-dimethylpiperidine;3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanal;ethane |
|---|---|
| PubChem CID | 145076605 |
| Molecular Formula | C32H60N2O11 |
| Molecular Weight | 648.84 g/mol |
| Exact Mass | 648.42 |
| IUPAC Name | 1,4-dimethylpiperidine;3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanal;ethane |
| SMILES | CC.CC1CCN(C)CC1.O=CCCOCCOCCOCCOCCOCCOCCOCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C23H39NO11.C7H15N.C2H6/c25-5-1-6-28-8-10-30-12-14-32-16-18-34-20-21-35-19-17-33-15-13-31-11-9-29-7-4-24-22(26)2-3-23(24)27;1-7-3-5-8(2)6-4-7;1-2/h2-3,5H,1,4,6-21H2;7H,3-6H2,1-2H3;1-2H3 |
| InChIKey | IICWAYOJUKBJHE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 131.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.84 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|