About 6-hydroxy-1-(4-methylpiperidin-1-yl)hexan-1-one;pentane
6-hydroxy-1-(4-methylpiperidin-1-yl)hexan-1-one;pentane (PubChem CID 145077037) has the molecular formula C17H35NO2
and a molecular weight of 285.47 g/mol. Its IUPAC name is 6-hydroxy-1-(4-methylpiperidin-1-yl)hexan-1-one;pentane.
Molecular Properties
| Compound Name | 6-hydroxy-1-(4-methylpiperidin-1-yl)hexan-1-one;pentane |
| PubChem CID | 145077037 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | 6-hydroxy-1-(4-methylpiperidin-1-yl)hexan-1-one;pentane |
| SMILES | CC1CCN(C(=O)CCCCCO)CC1.CCCCC |
| InChI | InChI=1S/C12H23NO2.C5H12/c1-11-6-8-13(9-7-11)12(15)5-3-2-4-10-14;1-3-5-4-2/h11,14H,2-10H2,1H3;3-5H2,1-2H3 |
| InChIKey | ROWGNBTUIRUZDJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-1-(4-methylpiperidin-1-yl)hexan-1-one;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-1-(4-methylpiperidin-1-yl)hexan-1-one;pentane?
The IUPAC name of 6-hydroxy-1-(4-methylpiperidin-1-yl)hexan-1-one;pentane (CID 145077037) is 6-hydroxy-1-(4-methylpiperidin-1-yl)hexan-1-one;pentane.
What is the SMILES notation for 6-hydroxy-1-(4-methylpiperidin-1-yl)hexan-1-one;pentane?
The canonical SMILES for 6-hydroxy-1-(4-methylpiperidin-1-yl)hexan-1-one;pentane is CC1CCN(C(=O)CCCCCO)CC1.CCCCC.
What is the InChIKey of 6-hydroxy-1-(4-methylpiperidin-1-yl)hexan-1-one;pentane?
The InChIKey is ROWGNBTUIRUZDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2.C5H12/c1-11-6-8-13(9-7-11)12(15)5-3-2-4-10-14;1-3-5-4-2/h11,14H,2-10H2,1H3;3-5H2,1-2H3.
What are the key properties of 6-hydroxy-1-(4-methylpiperidin-1-yl)hexan-1-one;pentane?
6-hydroxy-1-(4-methylpiperidin-1-yl)hexan-1-one;pentane has a molecular weight of 285.47 g/mol, XLogP of 3.99, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-1-(4-methylpiperidin-1-yl)hexan-1-one;pentane is sourced from PubChem (CID 145077037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).