C31H32F6NO5S3+ — CID 145077085
[3-[[3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-1,1,2,2,3,3-hexafluoropropyl]sulfonyloxymethyl]phenyl]-diphenylsulfanium (PubChem CID 145077085) has the molecular formula C31H32F6NO5S3+ and a molecular weight of 708.79 g/mol. Its IUPAC name is [3-[[3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-1,1,2,2,3,3-hexafluoropropyl]sulfonyloxymethyl]phenyl]-diphenylsulfanium.
| Compound Name | [3-[[3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-1,1,2,2,3,3-hexafluoropropyl]sulfonyloxymethyl]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 145077085 |
| Molecular Formula | C31H32F6NO5S3+ |
| Molecular Weight | 708.79 g/mol |
| Exact Mass | 708.13 |
| IUPAC Name | [3-[[3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-1,1,2,2,3,3-hexafluoropropyl]sulfonyloxymethyl]phenyl]-diphenylsulfanium |
| SMILES | O=S(=O)(OCc1cccc([S+](c2ccccc2)c2ccccc2)c1)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C31H32F6NO5S3/c32-29(33,30(34,35)45(39,40)38-19-18-24-11-7-8-12-25(24)21-38)31(36,37)46(41,42)43-22-23-10-9-17-28(20-23)44(26-13-3-1-4-14-26)27-15-5-2-6-16-27/h1-6,9-10,13-17,20,24-25H,7-8,11-12,18-19,21-22H2/q+1 |
| InChIKey | WDWHOENUQZVFED-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.79 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|