C42H38N3+ — CID 145077673
[amino-[3-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)phenyl]methyl]-phenyl-(1-phenylethyl)azanium (PubChem CID 145077673) has the molecular formula C42H38N3+ and a molecular weight of 584.79 g/mol. Its IUPAC name is [amino-[3-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)phenyl]methyl]-phenyl-(1-phenylethyl)azanium.
| Compound Name | [amino-[3-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)phenyl]methyl]-phenyl-(1-phenylethyl)azanium |
|---|---|
| PubChem CID | 145077673 |
| Molecular Formula | C42H38N3+ |
| Molecular Weight | 584.79 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | [amino-[3-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)phenyl]methyl]-phenyl-(1-phenylethyl)azanium |
| SMILES | CC(c1ccccc1)[NH+](c1ccccc1)C(N)c1cccc(-n2c3ccccc3c3ccc4c(c32)C(C)(C)c2ccccc2-4)c1 |
| InChI | InChI=1S/C42H37N3/c1-28(29-15-6-4-7-16-29)44(31-18-8-5-9-19-31)41(43)30-17-14-20-32(27-30)45-38-24-13-11-22-34(38)36-26-25-35-33-21-10-12-23-37(33)42(2,3)39(35)40(36)45/h4-28,41H,43H2,1-3H3/p+1 |
| InChIKey | VPORGGPWZHIRMC-UHFFFAOYSA-O |
| XLogP | 9.03 |
| TPSA | 35.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.79 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|